CAS 745738-13-0

N-[(1,1-Dimethylethoxy)carbonyl]-4-hydroxyleucine

Description:

N-[(1,1-Dimethylethoxy)carbonyl]-4-hydroxyleucine is a chemical compound characterized by its unique structure, which includes a leucine amino acid backbone modified with a dimethylethoxycarbonyl group. This modification enhances its stability and solubility, making it suitable for various applications in pharmaceutical and biochemical research. The presence of the hydroxyl group at the 4-position of the leucine side chain contributes to its potential as a building block in peptide synthesis and drug development. The compound is typically a white to off-white solid, and its solubility can vary depending on the solvent used. It is important to handle this substance with care, following appropriate safety protocols, as it may exhibit biological activity. Additionally, its CAS number, 745738-13-0, serves as a unique identifier for regulatory and research purposes, facilitating its recognition in chemical databases and literature. Overall, this compound represents a valuable tool in the field of medicinal chemistry and peptide synthesis.

Formula: C₁₁H₂₁NO₅

InChI: InChI=1S/C11H21NO5/c1-10(2,3)17-9(15)12-7(8(13)14)6-11(4,5)16/h7,16H,6H2,1-5H3,(H,12,15)(H,13,14)

InChI key: InChIKey=WIVLTTKGLJRFJH-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CC(C)(C)O)C(O)=O

Synonyms:

• Leucine, N-[(1,1-dimethylethoxy)carbonyl]-4-hydroxy-
• N-[(1,1-Dimethylethoxy)carbonyl]-4-hydroxyleucine