CAS 745775-31-9
:3-Amino-3-(3-isopropoxyphenyl)propanoic acid
Description:
3-Amino-3-(3-isopropoxyphenyl)propanoic acid is an organic compound characterized by its amino acid structure, featuring an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a propanoic acid backbone. The presence of a 3-isopropoxyphenyl group enhances its hydrophobic characteristics, which can influence its solubility and interaction with biological systems. This compound may exhibit properties typical of amino acids, such as participating in peptide bond formation and acting as a building block for proteins. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The compound's CAS number, 745775-31-9, allows for precise identification in chemical databases and literature. Overall, 3-Amino-3-(3-isopropoxyphenyl)propanoic acid represents a unique structure that combines amino acid functionality with aromatic characteristics, making it of interest in both synthetic and medicinal chemistry.
Formula:C12H17NO3
InChI:InChI=1/C12H17NO3/c1-8(2)16-10-5-3-4-9(6-10)11(13)7-12(14)15/h3-6,8,11H,7,13H2,1-2H3,(H,14,15)
SMILES:CC(C)Oc1cccc(c1)C(CC(=O)O)N
Synonyms:- Benzenepropanoic Acid, Β-Amino-3-(1-Methylethoxy)-
- 3-Amino-3-[3-(Propan-2-Yloxy)Phenyl]Propanoic Acid
- 3-Amino-3-(3-isopropoxyphenyl)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.