CAS 745783-73-7
:1-Fluoro-4-[(1R)-1-isocyanatoethyl]benzene
Description:
1-Fluoro-4-[(1R)-1-isocyanatoethyl]benzene, with the CAS number 745783-73-7, is an organic compound characterized by the presence of a fluorine atom and an isocyanate functional group attached to a benzene ring. The structure features a fluoro substituent at the para position relative to the isocyanate group, which is linked to a chiral carbon center. This compound is likely to exhibit reactivity typical of isocyanates, including the ability to form urethanes through reaction with alcohols or amines. The presence of the fluorine atom may influence its chemical properties, such as polarity and reactivity, potentially enhancing its electrophilic character. Additionally, the isocyanate group is known for its utility in various chemical syntheses, including the production of polyurethanes and other polymers. Safety considerations are important when handling this compound, as isocyanates can be hazardous, posing risks such as respiratory irritation and sensitization. Overall, 1-Fluoro-4-[(1R)-1-isocyanatoethyl]benzene represents a specialized compound with applications in materials science and organic synthesis.
Formula:C9H8FNO
InChI:InChI=1S/C9H8FNO/c1-7(11-6-12)8-2-4-9(10)5-3-8/h2-5,7H,1H3/t7-/m1/s1
InChI key:InChIKey=MUHCZVYPBWOTTJ-SSDOTTSWSA-N
SMILES:[C@@H](N=C=O)(C)C1=CC=C(F)C=C1
Synonyms:- (R)-1-Fluoro-4-(1-isocyanatoethyl)benzene
- 1-Fluoro-4-[(1R)-1-isocyanatoethyl]benzene
- Benzene, 1-fluoro-4-[(1R)-1-isocyanatoethyl]- (9CI)
- (R)-1-(4-Fluorophenyl)ethyl isocyanate
- Benzene, 1-fluoro-4-[(1R)-1-isocyanatoethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
