CAS 745783-81-7
:(1S)-2,3-Dihydro-1-isocyanato-1H-indene
Description:
(1S)-2,3-Dihydro-1-isocyanato-1H-indene is a chemical compound characterized by its unique structure, which includes an indene ring fused with a dihydro group and an isocyanate functional group. The presence of the isocyanate group (-N=C=O) indicates that this compound can participate in various chemical reactions, particularly those involving nucleophiles, making it a potential candidate for applications in organic synthesis and materials science. The stereochemistry of the compound, denoted by the (1S) configuration, suggests specific spatial arrangements that can influence its reactivity and interactions with biological systems. Additionally, the compound's molecular weight, solubility, and stability under various conditions are important characteristics that determine its practical applications. As with many isocyanates, it may exhibit toxicity and require careful handling. Overall, (1S)-2,3-Dihydro-1-isocyanato-1H-indene represents a versatile building block in organic chemistry, with potential uses in pharmaceuticals, agrochemicals, and polymer chemistry.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c12-7-11-10-6-5-8-3-1-2-4-9(8)10/h1-4,10H,5-6H2/t10-/m0/s1
InChI key:InChIKey=XUEHOPNFOYAYTA-JTQLQIEISA-N
SMILES:N(=C=O)[C@@H]1C=2C(CC1)=CC=CC2
Synonyms:- (1S)-2,3-Dihydro-1-isocyanato-1H-indene
- (s)-(+)-1-Indanyl isocyanate
- 1H-Indene, 2,3-dihydro-1-isocyanato-, (1S)-
- (1S)-1-Isocyanato-2,3-dihydro-1H-indene
- (S)-1-Isocyanatoindane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
