CAS 745783-82-8

1-[(1R)-1-Isocyanatoethyl]-4-methoxybenzene

Description:

1-[(1R)-1-Isocyanatoethyl]-4-methoxybenzene, with the CAS number 745783-82-8, is an organic compound characterized by the presence of both isocyanate and methoxy functional groups. This compound features a methoxy group (-OCH3) attached to a benzene ring, which enhances its reactivity and solubility in organic solvents. The isocyanate group (-N=C=O) is known for its high reactivity, particularly in forming urethane linkages, making this compound useful in various chemical syntheses, including the production of polymers and pharmaceuticals. The specific stereochemistry indicated by the (1R) configuration suggests that the compound has a defined spatial arrangement, which can influence its reactivity and interaction with biological systems. Additionally, the presence of the isocyanate group can pose health hazards, as isocyanates are known to be irritants and potential sensitizers. Therefore, handling this compound requires appropriate safety precautions. Overall, this substance is significant in materials science and medicinal chemistry due to its unique structural features and reactivity.

Formula: C₁₀H₁₁NO₂

InChI: InChI=1S/C10H11NO2/c1-8(11-7-12)9-3-5-10(13-2)6-4-9/h3-6,8H,1-2H3/t8-/m1/s1

InChI key: InChIKey=WTNKKJUXEYSETC-MRVPVSSYSA-N

SMILES: [C@@H](N=C=O)(C)C1=CC=C(OC)C=C1

Synonyms:

• 1-[(1R)-1-Isocyanatoethyl]-4-methoxybenzene
• Benzene, 1-[(1R)-1-isocyanatoethyl]-4-methoxy- (9CI)
• Benzene, 1-[(1R)-1-isocyanatoethyl]-4-methoxy-

(R)-(+)-1-(4-Methoxyphenyl)ethyl isocyanate

CAS: 745783-82-8

Formula: C₁₀H₁₁NO₂

Purity: 98.0%

Color and Shape: Liquid

Molecular weight: 177.203

Ref: 10-F099849