CAS 745783-84-0
:(2R)-2-Isocyanato-3-methylbutane
Description:
(2R)-2-Isocyanato-3-methylbutane is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a branched alkane structure. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the (2R) configuration. Isocyanates are known for their reactivity, particularly in forming urethanes through reactions with alcohols and amines. The presence of the methyl group at the third carbon position adds to the compound's steric properties, influencing its reactivity and interactions with other molecules. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various polymers and pharmaceuticals. Due to the isocyanate group, it can be hazardous, requiring careful handling to avoid respiratory irritation and skin sensitization. Overall, (2R)-2-Isocyanato-3-methylbutane exemplifies the diverse chemistry of isocyanates and their applications in synthetic organic chemistry.
Formula:C6H11NO
InChI:InChI=1S/C6H11NO/c1-5(2)6(3)7-4-8/h5-6H,1-3H3/t6-/m1/s1
InChI key:InChIKey=UCSWKSXDJYECKQ-ZCFIWIBFSA-N
SMILES:[C@H](N=C=O)(C(C)C)C
Synonyms:- (2R)-2-isocyanato-3-methylbutane
- Butane, 2-isocyanato-3-methyl-, (2R)-
- (R)-3-Methylbutan-2-yl isocyanate
- (r)-(-)-3-Methyl-2-butyl isocyanate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
