CAS 745783-86-2
:(2R)-2-Isocyanatooctane
Description:
(2R)-2-Isocyanatooctane is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a linear octane chain. This compound is a chiral molecule, with the "R" designation indicating the specific configuration of the chiral center at the second carbon atom. Isocyanates are known for their reactivity, particularly in forming urethanes and other polymers through reactions with alcohols and amines. The presence of the octane chain contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is typically used in the synthesis of various chemical intermediates and materials, including coatings, adhesives, and foams. Safety considerations are important when handling isocyanates, as they can be irritants and sensitizers, necessitating appropriate protective measures. Overall, (2R)-2-Isocyanatooctane is a versatile compound with significant applications in the chemical industry.
Formula:C9H17NO
InChI:InChI=1S/C9H17NO/c1-3-4-5-6-7-9(2)10-8-11/h9H,3-7H2,1-2H3/t9-/m1/s1
InChI key:InChIKey=FTWPDIQXUDUDPL-SECBINFHSA-N
SMILES:[C@@H](CCCCCC)(N=C=O)C
Synonyms:- Octane, 2-isocyanato-, (2R)-
- (2R)-2-Isocyanatooctane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.