
CAS 745784-01-4
:1-Bromo-4-[(1R)-1-isothiocyanatoethyl]benzene
Description:
1-Bromo-4-[(1R)-1-isothiocyanatoethyl]benzene is an organic compound characterized by the presence of a bromine atom and an isothiocyanate functional group attached to a benzene ring. The compound features a bromobenzene structure, where the bromine atom is located at the para position relative to the isothiocyanate substituent. The isothiocyanate group (-N=C=S) is known for its reactivity and is often involved in various chemical reactions, including nucleophilic substitutions and the formation of thioureas. The presence of the isothiocyanate group can impart biological activity, making such compounds of interest in medicinal chemistry and agrochemicals. Additionally, the stereochemistry indicated by the (1R) configuration suggests a specific spatial arrangement of atoms, which can influence the compound's reactivity and interactions. Overall, 1-Bromo-4-[(1R)-1-isothiocyanatoethyl]benzene is a compound with potential applications in research and industry, particularly in the fields of organic synthesis and pharmacology.
Formula:C9H8BrNS
InChI:InChI=1S/C9H8BrNS/c1-7(11-6-12)8-2-4-9(10)5-3-8/h2-5,7H,1H3/t7-/m1/s1
InChI key:InChIKey=YSTNXBHZXWCFQE-SSDOTTSWSA-N
SMILES:[C@@H](N=C=S)(C)C1=CC=C(Br)C=C1
Synonyms:- Benzene, 1-bromo-4-[(1R)-1-isothiocyanatoethyl]-
- (r)-(+)-1-(4-Bromophenyl)ethyl isothiocyanate
- 1-Bromo-4-[(1R)-1-isothiocyanatoethyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
