CAS 745784-06-9
:Boronic acid, (4-bromo-3-quinolinyl)-
Description:
Boronic acid, (4-bromo-3-quinolinyl)-, identified by CAS number 745784-06-9, is an organic compound characterized by the presence of a boronic acid functional group attached to a quinoline ring system. This compound typically exhibits properties associated with both boronic acids and heterocyclic aromatic compounds. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the bromine atom at the 4-position of the quinoline ring can influence its reactivity and solubility, potentially enhancing its utility in cross-coupling reactions and as a building block in drug development. Additionally, the quinoline structure contributes to its aromaticity and may impart biological activity, making it of interest in the study of pharmaceuticals. Overall, this compound exemplifies the intersection of boron chemistry and heterocyclic chemistry, showcasing the versatility of boronic acids in synthetic applications.
Formula:C9H7BBrNO2
InChI:InChI=1S/C9H7BBrNO2/c11-9-6-3-1-2-4-8(6)12-5-7(9)10(13)14/h1-5,13-14H
InChI key:InChIKey=MJWHSJOTPNCANL-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=CC1B(O)O)C=CC=C2
Synonyms:- Boronic acid, (4-bromo-3-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
