CAS 745817-34-9
:Piperidine, 3-[(3-fluorophenyl)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(3-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 3-fluorobenzyl group attached to the piperidine nitrogen contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the fluorine atom in the aromatic ring may influence the compound's lipophilicity and metabolic stability. Safety and handling precautions are essential, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a specific class of piperidine derivatives that may have significant implications in drug development and research.
Formula:C12H17ClFN
InChI:InChI=1/C12H16FN.ClH/c13-12-5-1-3-10(8-12)7-11-4-2-6-14-9-11;/h1,3,5,8,11,14H,2,4,6-7,9H2;1H
InChI key:InChIKey=BKZUAEOSTNZAMT-UHFFFAOYSA-N
SMILES:C(C1=CC(F)=CC=C1)C2CCCNC2.Cl
Synonyms:- 3-(3-Fluorobenzyl)piperidine hydrochloride (1:1)
- Piperidine, 3-[(3-Fluorophenyl)Methyl]-, Hydrochloride (1:1)
- Piperidine, 3-[(3-fluorophenyl)methyl]-, hydrochloride
- 3-(3-FLUORO-BENZYL)-PIPERIDINE HYDROCHLORIDE
- 3-[(3-fluorophenyl)methyl]piperidine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.