CAS 745822-33-7

(3S)-3-[(4-fluorophenyl)methyl]piperidine hydrochloride

Description:

(3S)-3-[(4-fluorophenyl)methyl]piperidine hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorophenyl group at the 3-position of the piperidine contributes to its unique properties, including potential lipophilicity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a neurotransmitter modulator or having implications in the treatment of neurological disorders. Its stereochemistry, indicated by the (3S) designation, suggests specific spatial arrangements that can influence its interaction with biological targets. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Overall, (3S)-3-[(4-fluorophenyl)methyl]piperidine hydrochloride represents a compound of interest in medicinal chemistry and drug development.

Formula: C₁₂H₁₇ClFN

InChI: InChI=1/C12H16FN.ClH/c13-12-5-3-10(4-6-12)8-11-2-1-7-14-9-11;/h3-6,11,14H,1-2,7-9H2;1H/t11-;/m0./s1

SMILES: C1C[C@@H](Cc2ccc(cc2)F)CNC1.Cl

6-FLUOROCHROMANO-4-ONE

CAS: 745822-33-7

Formula: C₁₂H₁₇ClFN

Purity: 96%

Molecular weight: 229.7215

Ref: IN-DA00FAWN

(S)-3-(4-Fluorobenzyl)piperidine Hydrochloride

CAS: 745822-33-7

Please enquire for more information about (S)-3-(4-Fluorobenzyl)piperidine Hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₆NF·HCl

Purity: Min. 95%

Molecular weight: 229.72 g/mol

Ref: 3D-VEB82233