CAS 745833-19-6
:Ethyl 2-(2,4-difluorophenyl)-6-chloronicotinate
Description:
Ethyl 2-(2,4-difluorophenyl)-6-chloronicotinate is a chemical compound characterized by its unique structure, which includes a nicotinic acid derivative with an ethyl ester functional group. This compound features a chlorinated pyridine ring and a difluorophenyl substituent, contributing to its potential biological activity and chemical reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of fluorine and chlorine atoms can influence its electronic properties, making it of interest in medicinal chemistry and material science. Ethyl 2-(2,4-difluorophenyl)-6-chloronicotinate may be synthesized through various organic reactions, including esterification and halogenation processes. Its specific applications can vary, but it may be explored for use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the presence of halogens can indicate potential hazards.
Formula:C14H10ClF2NO2
InChI:InChI=1/C14H10ClF2NO2/c1-2-20-14(19)10-5-6-12(15)18-13(10)9-4-3-8(16)7-11(9)17/h3-7H,2H2,1H3
SMILES:CCOC(=O)c1ccc(Cl)nc1c1ccc(cc1F)F
Synonyms:- 6-Chloro-2-(2,4-difluoro-phenyl)nicotinic acid ethyl ester
- 2-(2,4-difluorophenyl-Ethyl)-6-chloronicotinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
