CAS 7459-35-0
:elaidoyl chloride
Description:
Elaidoyl chloride, with the CAS number 7459-35-0, is an organic compound that belongs to the class of acyl chlorides. It is derived from elaidic acid, which is an unsaturated fatty acid. This compound typically appears as a colorless to pale yellow liquid and is known for its pungent odor. Elaidoyl chloride is characterized by the presence of a carbonyl group (C=O) adjacent to a chlorine atom, which makes it highly reactive, particularly in nucleophilic substitution reactions. It is soluble in organic solvents such as ether and chloroform but is generally insoluble in water due to its hydrophobic nature. The reactivity of elaidoyl chloride allows it to be used in various chemical syntheses, including the preparation of amides and esters. However, it should be handled with care, as it can be corrosive and may cause irritation to the skin and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound.
Formula:C18H33ClO
InChI:InChI=1/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3/b10-9+
Synonyms:- (9E)-octadec-9-enoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
9(E)-Octadecenoyl chloride
CAS:Formula:C18H33ClOPurity:>99%Color and Shape:LiquidMolecular weight:300.919(E)-Octadecenoyl chloride
CAS:9(E)-Octadecenoyl chloride is a specialized chemical compound, which is an acyl chloride derivative. It is primarily sourced from oleic acid, a monounsaturated fatty acid typically obtained from natural oils and fats through industrial chemical processes. The mode of action of 9(E)-Octadecenoyl chloride involves its reactive acyl chloride functional group, which readily undergoes nucleophilic acyl substitution reactions. This reactivity makes it a valuable intermediate in the synthesis of various esters, amides, and anhydrides.Formula:C18H33ClOPurity:Min. 95%Molecular weight:300.9 g/mol

