CAS 7459-63-4

6-Phenyl-1,3,5-triazine-2,4(1H,3H)-dione

Description:

6-Phenyl-1,3,5-triazine-2,4(1H,3H)-dione, also known by its CAS number 7459-63-4, is a heterocyclic organic compound characterized by a triazine ring structure substituted with a phenyl group and two carbonyl (keto) groups. This compound typically exhibits a yellow to orange color and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the triazine ring contributes to its stability and reactivity, making it a useful scaffold in organic synthesis. It may also exhibit interesting electronic properties due to the conjugation between the phenyl group and the triazine moiety. Additionally, the compound can participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, which are valuable in synthetic chemistry. Its solubility and behavior in different solvents can vary, influencing its application in formulations. Overall, 6-Phenyl-1,3,5-triazine-2,4(1H,3H)-dione is a versatile compound with significant potential in research and industrial applications.

Formula: C₉H₇N₃O₂

InChI: InChI=1S/C9H7N3O2/c13-8-10-7(11-9(14)12-8)6-4-2-1-3-5-6/h1-5H,(H2,10,11,12,13,14)

InChI key: InChIKey=KGKPZSCTAFFXBV-UHFFFAOYSA-N

SMILES: O=C1NC(=NC(=O)N1)C2=CC=CC=C2

Synonyms:

• 1,3,5-Triazine-2,4(1H,3H)-dione, 6-phenyl-
• 2,4-Dihydroxy-6-phenyl-s-triazine
• 6-Phenyl-1,3,5-triazine-2,4(1H,3H)-dione
• s-Triazine-2,4(1H,3H)-dione, 6-phenyl-
• s-Triazine-2,4-diol, 6-phenyl-