CAS 74592-71-5

(2,3,5-trimethylphenoxy)acetic acid

Description:

(2,3,5-trimethylphenoxy)acetic acid is an organic compound characterized by its phenoxyacetic acid structure, which includes a phenolic ring substituted with three methyl groups at the 2, 3, and 5 positions. This substitution pattern contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The presence of the acetic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound is typically used in agricultural applications, particularly as a herbicide or plant growth regulator, due to its ability to influence plant growth processes. Its solubility in organic solvents and moderate solubility in water make it versatile for formulation in various products. Safety and handling considerations are essential, as with many chemical substances, and it is advisable to refer to material safety data sheets (MSDS) for specific information regarding toxicity and environmental impact. Overall, (2,3,5-trimethylphenoxy)acetic acid is a significant compound in both industrial and research contexts.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c1-7-4-8(2)9(3)10(5-7)14-6-11(12)13/h4-5H,6H2,1-3H3,(H,12,13)

SMILES: Cc1cc(C)c(C)c(c1)OCC(=O)O

Synonyms:

• Acetic Acid, 2-(2,3,5-Trimethylphenoxy)-