CymitQuimica logo

CAS 7460-80-2

:

oxiran-2-ylmethyl tetradecanoate

Description:
Oxiran-2-ylmethyl tetradecanoate, also known as 2-(tetradecanoyloxy)ethyl oxirane, is an organic compound characterized by the presence of an epoxide group (oxirane) and a long-chain fatty acid ester. The tetradecanoate portion indicates that it is derived from tetradecanoic acid (myristic acid), which contributes to its hydrophobic properties and potential applications in surfactants or emulsifiers. The epoxide group imparts reactivity, allowing for further chemical modifications, such as ring-opening reactions, which can be utilized in polymer synthesis or as intermediates in organic reactions. This compound is typically a colorless to pale yellow liquid, exhibiting low volatility and moderate solubility in organic solvents. Its properties make it suitable for use in various industrial applications, including coatings, adhesives, and as a potential additive in cosmetic formulations. Safety data should be consulted for handling and exposure guidelines, as compounds with epoxide groups can be reactive and may pose health risks if not managed properly.
Formula:C17H32O3
InChI:InChI=1/C17H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(18)20-15-16-14-19-16/h16H,2-15H2,1H3
InChI key:WVRMZLGUSWWTOZ-UHFFFAOYSA-N
SMILES:CCCCCCCCCCCCCC(=O)OCC1CO1
Found 5 products.