CymitQuimica logo

CAS 74602-56-5

:

2-amino-5-bromo-6-(2-fluorophenyl)pyrimidin-4(1H)-one

Description:
2-amino-5-bromo-6-(2-fluorophenyl)pyrimidin-4(1H)-one is a heterocyclic organic compound characterized by a pyrimidine ring substituted with various functional groups. The presence of an amino group at the 2-position and a bromo group at the 5-position contributes to its reactivity and potential biological activity. The 6-position features a 2-fluorophenyl group, which can influence the compound's lipophilicity and interaction with biological targets. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as many pyrimidine derivatives are known for their antiviral, anticancer, and anti-inflammatory properties. The specific arrangement of substituents can significantly affect the compound's pharmacokinetics and pharmacodynamics, making it a subject of interest in drug design and discovery. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C10H7BrFN3O
InChI:InChI=1/C10H7BrFN3O/c11-7-8(14-10(13)15-9(7)16)5-3-1-2-4-6(5)12/h1-4H,(H3,13,14,15,16)
SMILES:c1ccc(c(c1)c1c(c(nc(=N)[nH]1)O)Br)F
Synonyms:
  • 4(1H)-Pyrimidinone, 2-amino-5-bromo-6-(2-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.