CAS 74602-59-8
:2-amino-5-bromo-6-(3-fluorophenyl)pyrimidin-4(1H)-one
Description:
2-amino-5-bromo-6-(3-fluorophenyl)pyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its pyrimidine ring structure, which features multiple functional groups. The presence of an amino group (-NH2) at the 2-position and a bromine atom at the 5-position contributes to its reactivity and potential biological activity. The 6-position is substituted with a 3-fluorophenyl group, which can influence the compound's lipophilicity and interaction with biological targets. This compound is typically used in medicinal chemistry and drug development due to its potential as a pharmacophore. Its molecular structure suggests it may exhibit various biological activities, including antimicrobial or anticancer properties, although specific activities would depend on further empirical studies. Additionally, the presence of halogen atoms like bromine and fluorine can enhance the compound's stability and bioavailability. As with many heterocycles, the compound's solubility, melting point, and other physical properties would be influenced by its specific substituents and overall molecular geometry.
Formula:C10H7BrFN3O
InChI:InChI=1/C10H7BrFN3O/c11-7-8(14-10(13)15-9(7)16)5-2-1-3-6(12)4-5/h1-4H,(H3,13,14,15,16)
SMILES:c1cc(cc(c1)F)c1c(c(nc(=N)[nH]1)O)Br
Synonyms:- 2-Amino-5-bromo-6-(3-fluorophenyl)-4(1H)-pyrimidinone
- 4(1H)-pyrimidinone, 2-amino-5-bromo-6-(3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.