CAS 74602-60-1

2-amino-6-(3-fluorophenyl)-5-iodopyrimidin-4(1H)-one

Description:

2-amino-6-(3-fluorophenyl)-5-iodopyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms. This compound features an amino group at the 2-position, a fluorophenyl group at the 6-position, and an iodine atom at the 5-position, contributing to its unique chemical properties. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity, while the iodine atom can affect its reactivity and stability. This compound is likely to exhibit polar characteristics due to the amino group, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often explored for their biological activities, including antiviral and anticancer properties. The compound's CAS number, 74602-60-1, allows for easy identification in chemical databases and literature. Overall, its unique functional groups and structural features make it a compound of interest in various chemical and biological research fields.

Formula: C₁₀H₇FIN₃O

InChI: InChI=1/C10H7FIN3O/c11-6-3-1-2-5(4-6)8-7(12)9(16)15-10(13)14-8/h1-4H,(H3,13,14,15,16)

SMILES: c1cc(cc(c1)F)c1c(c(nc(=N)[nH]1)O)I

Synonyms:

• 4(1H)-Pyrimidinone, 2-amino-6-(3-fluorophenyl)-5-iodo-