CAS 74605-21-3

2-Pentanamine, 1-bromo-4-methyl-, (S)-

Description:

2-Pentanamine, 1-bromo-4-methyl-, (S)-, with the CAS number 74605-21-3, is an organic compound characterized by its amine and bromo functional groups. As a chiral molecule, it exists in a specific stereoisomeric form, denoted by the (S) configuration, which influences its biological activity and interactions. This compound features a five-carbon pentane backbone, with a bromine atom attached to the first carbon and a methyl group on the fourth carbon, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the amine group suggests it may exhibit basic properties and can participate in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the bromine substituent can enhance reactivity in nucleophilic substitution reactions. Due to its structural characteristics, this compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. Safety precautions should be observed when handling this substance, as it may pose health risks.

Formula: C₆H₁₄BrN

InChI: InChI=1S/C6H14BrN/c1-5(2)3-6(8)4-7/h5-6H,3-4,8H2,1-2H3/t6-/m0/s1

InChI key: InChIKey=IZIKWFKRKGNEEJ-LURJTMIESA-N

SMILES: [C@H](CC(C)C)(CBr)N

Synonyms:

• 2-Pentanamine, 1-bromo-4-methyl-, (S)-
• (2S)-1-Bromo-4-methylpentan-2-amine