CAS 7461-32-7

4-chloro-N-propylbenzamide

Description:

4-Chloro-N-propylbenzamide is an organic compound characterized by its amide functional group, where a propyl group is attached to the nitrogen atom and a chloro substituent is located at the para position of the benzene ring. This compound typically appears as a solid or crystalline substance and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the propyl group and the aromatic ring. The presence of the chlorine atom introduces unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Additionally, 4-chloro-N-propylbenzamide may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.

Formula: C₁₀H₁₂ClNO

InChI: InChI=1/C10H12ClNO/c1-2-7-12-10(13)8-3-5-9(11)6-4-8/h3-6H,2,7H2,1H3,(H,12,13)

SMILES: CCCNC(=O)c1ccc(cc1)Cl

Synonyms:

• benzamide, 4-chloro-N-propyl-

4-Chloro-N-n-propylbenzamide

CAS: 7461-32-7

4-Chloro-N-n-propylbenzamide

Purity: 95%

Molecular weight: 197.66g/mol

Ref: 54-OR957101