CAS 74613-66-4

lithium bis(2,2,2-trifluoroethyl)carbamodithioate

Description:

Lithium bis(2,2,2-trifluoroethyl)carbamodithioate, with the CAS number 74613-66-4, is a chemical compound that belongs to the class of lithium salts. It is characterized by the presence of lithium ions coordinated with a bis(2,2,2-trifluoroethyl)carbamodithioate anion. This compound features a dithioate functional group, which contributes to its unique chemical properties, including potential applications in various fields such as materials science and electrochemistry. The trifluoroethyl groups enhance the compound's stability and solubility in organic solvents, making it suitable for use in specialized formulations. Additionally, the presence of fluorine atoms imparts distinctive electronic properties, which may influence its reactivity and interactions with other substances. Overall, lithium bis(2,2,2-trifluoroethyl)carbamodithioate is notable for its potential utility in advanced chemical applications, particularly in the development of lithium-based batteries and other electrochemical systems.

Formula: C₅H₄F₆LiNS₂

InChI: InChI=1/C5H5F6NS2.Li/c6-4(7,8)1-12(3(13)14)2-5(9,10)11;/h1-2H2,(H,13,14);/q;+1/p-1

SMILES: C(C(F)(F)F)N(CC(F)(F)F)C(=S)S.[Li]

Synonyms:

• Carbamodithioic acid, bis(2,2,2-trifluoroethyl)-, lithium salt
• carbamodithioic acid, N,N-bis(2,2,2-trifluoroethyl)-, lithium salt (1:1)