CAS 7462-73-9
:2-Chlorobutyramide
Description:
2-Chlorobutyramide is an organic compound characterized by the presence of a butyramide structure with a chlorine atom substituted at the second carbon position. Its molecular formula is C4H8ClN, and it features a primary amide functional group, which contributes to its reactivity and solubility properties. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. 2-Chlorobutyramide is known for its potential applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and agrochemicals. It exhibits moderate polarity due to the presence of the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the chlorine substituent can impart unique reactivity, making it a useful building block in various chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken to minimize exposure.
Formula:C4H8ClNO
InChI:InChI=1/C4H8ClNO/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H2,6,7)/t3-/m1/s1
SMILES:CC[C@H](C(=N)O)Cl
Synonyms:- 2-Chlorobutanamide
- (2R)-2-chlorobutanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chlorobutyramide, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4H8ClNOPurity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:121.56



