CAS 7462-84-2

1-methylpiperidine-4-carbonyl chloride

Description:

1-Methylpiperidine-4-carbonyl chloride, with the CAS number 7462-84-2, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a carbonyl chloride functional group indicates that it is an acyl chloride, making it reactive and useful in various chemical syntheses. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water due to its hydrophobic nature. The carbonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic acyl substitution reactions, which are essential in the synthesis of amides and other derivatives. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon hydrolysis. Overall, 1-methylpiperidine-4-carbonyl chloride is significant in organic synthesis, particularly in the pharmaceutical and agrochemical industries.

Formula: C₇H₁₂ClNO

InChI: InChI=1/C7H12ClNO/c1-9-4-2-6(3-5-9)7(8)10/h6H,2-5H2,1H3

SMILES: CN1CCC(CC1)C(=O)Cl

1-Methylpiperidine-4-carbonyl chloride Hcl

CAS: 7462-84-2

1-Methylpiperidine-4-carbonyl chloride Hcl

Purity: 95%

Molecular weight: 198.09g/mol

Ref: 54-OR1003831