
CAS 7463-22-1
:4-Chloro-N,N-dimethylbenzenesulfonamide
Description:
4-Chloro-N,N-dimethylbenzenesulfonamide, with the CAS number 7463-22-1, is an organic compound that belongs to the class of sulfonamides. It features a sulfonamide functional group (-SO2NH2) attached to a benzene ring that is substituted with a chlorine atom at the para position and two methyl groups at the nitrogen atom. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the sulfonamide group. It exhibits properties characteristic of sulfonamides, including antibacterial activity, which makes it relevant in medicinal chemistry. The chlorine substituent can influence its reactivity and biological activity, while the dimethyl groups contribute to its steric properties. As with many sulfonamides, it may also exhibit potential for use in various chemical syntheses and applications in pharmaceuticals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H10ClNO2S
InChI:InChI=1S/C8H10ClNO2S/c1-10(2)13(11,12)8-5-3-7(9)4-6-8/h3-6H,1-2H3
InChI key:InChIKey=QFNLRDMGDKMXBO-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=CC=C(Cl)C=C1
Synonyms:- Benzenesulfonamide, 4-chloro-N,N-dimethyl-
- Benzenesulfonamide, p-chloro-N,N-dimethyl-
- Acaridim
- 4-Chloro-N,N-dimethylbenzenesulfonamide
- N,N-Dimethyl-4-chlorobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.