CAS 7463-30-1

N-(3-methylpyridin-2-yl)acetamide

Description:

N-(3-methylpyridin-2-yl)acetamide, with the CAS number 7463-30-1, is an organic compound characterized by its amide functional group and a pyridine ring. This compound features a 3-methyl substitution on the pyridine, which contributes to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the amide group that can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. Additionally, N-(3-methylpyridin-2-yl)acetamide can undergo typical reactions associated with amides, such as hydrolysis and acylation, under appropriate conditions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₀N₂O

InChI: InChI=1/C8H10N2O/c1-6-4-3-5-9-8(6)10-7(2)11/h3-5H,1-2H3,(H,9,10,11)

SMILES: Cc1cccnc1N=C(C)O

2-Acetamido-3-picoline

CAS: 7463-30-1

Formula: C₈H₁₀N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 150.1778

Ref: IN-DA005VXL

2-Acetamido-3-methylpyridine

CAS: 7463-30-1

Formula: C₈H₁₀N₂O

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 150.18

Ref: 3B-A3065

2-Acetamido-3-picoline

CAS: 7463-30-1

2-Acetamido-3-picoline

Purity: 98%

Molecular weight: 150.18g/mol

Ref: 54-OR902134

N-(3-Methylpyridin-2-yl)acetamide

CAS: 7463-30-1

Formula: C₈H₁₀N₂O

Purity: 98%(GC-MS);RG

Molecular weight: 150.181

Ref: 10-F209053