
CAS 74631-89-3
:1-Methyl-1H-indole-6-ethanamine
Description:
1-Methyl-1H-indole-6-ethanamine, with the CAS number 74631-89-3, is a chemical compound that belongs to the class of indole derivatives. It features a methyl group at the nitrogen atom of the indole ring and an ethylamine side chain at the 6-position of the indole structure. This compound is characterized by its aromatic indole core, which contributes to its potential biological activity. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility and reactivity. 1-Methyl-1H-indole-6-ethanamine may be of interest in medicinal chemistry and pharmacology due to its structural similarity to various neurotransmitters and psychoactive substances. Its specific interactions with biological targets, such as receptors or enzymes, would require further investigation to elucidate its potential therapeutic applications or effects. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c1-13-7-5-10-3-2-9(4-6-12)8-11(10)13/h2-3,5,7-8H,4,6,12H2,1H3
InChI key:InChIKey=DOZZBMFQPOGSQC-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC=C(CCN)C2)C=C1
Synonyms:- 1H-Indole-6-ethanamine, 1-methyl-
- 1-Methyl-1H-indole-6-ethanamine
- 2-(1-Methyl-1H-indol-6-yl)ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.