CAS 74639-14-8
:Liquiritin apioside
Description:
Liquiritin apioside is a flavonoid glycoside primarily derived from the root of Glycyrrhiza glabra, commonly known as licorice. It is characterized by its structure, which consists of a flavonoid aglycone (liquiritin) linked to an apiose sugar moiety. This compound exhibits various biological activities, including anti-inflammatory, antioxidant, and potential hepatoprotective effects. Liquiritin apioside is often studied for its pharmacological properties and is considered to contribute to the therapeutic effects of licorice in traditional medicine. It is soluble in water and organic solvents, making it suitable for various extraction and formulation processes. Additionally, its safety profile has been evaluated, indicating low toxicity at appropriate dosages. The compound's potential applications in nutraceuticals and pharmaceuticals are of significant interest, particularly in the context of herbal medicine and dietary supplements. Overall, liquiritin apioside represents a valuable component of licorice with promising health benefits and therapeutic potential.
Formula:C26H30O13
InChI:InChI=1S/C26H30O13/c27-9-19-20(31)21(32)22(39-25-23(33)26(34,10-28)11-35-25)24(38-19)36-14-4-1-12(2-5-14)17-8-16(30)15-6-3-13(29)7-18(15)37-17/h1-7,17,19-25,27-29,31-34H,8-11H2/t17-,19+,20+,21-,22+,23-,24+,25-,26+/m0/s1
InChI key:InChIKey=FTVKHUHJWDMWIR-DWMQJYMWSA-N
SMILES:O([C@H]1[C@H](OC2=CC=C(C=C2)[C@H]3OC=4C(C(=O)C3)=CC=C(O)C4)O[C@H](CO)[C@@H](O)[C@@H]1O)[C@H]5[C@H](O)[C@](CO)(O)CO5
Synonyms:- 4H-1-Benzopyran-4-one, 2-[4-[(2-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-2,3-dihydro-7-hydroxy-, (2S)-
- Liquiritin apioside
- Liquiritigenin 4′-O-apiosyl-O-glucoside
- 4H-1-Benzopyran-4-one, 2-[4-[(2-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-2,3-dihydro-7-hydroxy-, (S)-
- (2S)-2-[4-[(2-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-2,3-dihydro-7-hydroxy-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Liquiritin apioside
CAS:Formula:C26H30O13Purity:≥ 96.0%Color and Shape:White to off-white or faint yellow powderMolecular weight:550.51Liquiritin apioside
CAS:Liquiritin Apioside is one of the main active components in Suan-Zao-Ren decoction as a treatment for insomnia.Formula:C26H30O13Purity:99.08% - 99.53%Color and Shape:SolidMolecular weight:550.51Liquiritin apioside
CAS:Natural glycosideFormula:C26H30O13Purity:≥ 85.0 % (HPLC)Molecular weight:550.51Liquiritin apioside
CAS:Liquiritin apioside is a flavonoid glycoside, which is predominantly derived from the root of Glycyrrhiza uralensis, commonly known as licorice. This compound acts primarily through its anti-inflammatory and antioxidant properties, which involve the modulation of various cellular pathways. Specifically, it influences the activity of inflammatory cytokines and oxidative stress markers, potentially inhibiting pathways such as nuclear factor-kappa B (NF-κB).
Formula:C26H30O13Purity:Min. 95%Color and Shape:White PowderMolecular weight:550.51 g/mol






