CymitQuimica logo

CAS 7464-54-2

:

4-methoxy-N-(2-methylphenyl)benzamide

Description:
4-Methoxy-N-(2-methylphenyl)benzamide, identified by its CAS number 7464-54-2, is an organic compound characterized by its amide functional group, which is derived from benzoic acid. This compound features a methoxy group (-OCH3) attached to the para position of the benzene ring, enhancing its solubility and reactivity. The presence of the N-(2-methylphenyl) substituent indicates that a 2-methylphenyl group is attached to the nitrogen atom of the amide, contributing to its overall hydrophobic character. This structure suggests potential applications in pharmaceuticals or agrochemicals, as similar compounds often exhibit biological activity. The compound's melting point, boiling point, and solubility characteristics would typically be determined through experimental methods, as they can vary based on purity and environmental conditions. Additionally, its stability and reactivity can be influenced by the presence of functional groups, making it important to consider in synthetic and analytical chemistry contexts. Overall, 4-methoxy-N-(2-methylphenyl)benzamide represents a versatile structure with potential implications in various chemical applications.
Formula:C15H15NO2
InChI:InChI=1/C15H15NO2/c1-11-5-3-4-6-14(11)16-15(17)12-7-9-13(18-2)10-8-12/h3-10H,1-2H3,(H,16,17)
SMILES:Cc1ccccc1NC(=O)c1ccc(cc1)OC
Synonyms:
  • benzamide, 4-methoxy-N-(2-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.