CymitQuimica logo

CAS 7464-70-2

:

7-amino-1,3-dimethylpteridine-2,4(1H,3H)-dione

Description:
7-Amino-1,3-dimethylpteridine-2,4(1H,3H)-dione, commonly referred to as a derivative of pteridine, is a heterocyclic organic compound characterized by its bicyclic structure containing nitrogen atoms. This compound features an amino group and two methyl groups attached to the pteridine ring, contributing to its unique chemical properties. It is typically a crystalline solid that is soluble in polar solvents, reflecting its polar functional groups. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry and biochemistry. This compound may exhibit biological activity, particularly in relation to enzyme inhibition or as a precursor in the synthesis of other biologically relevant molecules. Its CAS number, 7464-70-2, is a unique identifier that facilitates its identification in chemical databases. Overall, the characteristics of this compound make it significant in various fields, including pharmaceuticals and biochemical research.
Formula:C8H9N5O2
InChI:InChI=1/C8H9N5O2/c1-12-6-5(10-3-4(9)11-6)7(14)13(2)8(12)15/h3H,1-2H3,(H2,9,11)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.