
CAS 74642-79-8
:(2E)-5-[(1R,3R,6S)-2,3-Dimethyltricyclo[2.2.1.02,6]hept-3-yl]-2-methyl-2-pentenoic acid
Description:
The chemical substance known as (2E)-5-[(1R,3R,6S)-2,3-Dimethyltricyclo[2.2.1.02,6]hept-3-yl]-2-methyl-2-pentenoic acid, with the CAS number 74642-79-8, is a complex organic compound characterized by its unique tricyclic structure and specific stereochemistry. This compound features a pentenoic acid moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple chiral centers indicates that it can exist in various stereoisomeric forms, which may influence its biological activity and interaction with other molecules. The tricyclic framework provides rigidity to the molecule, potentially affecting its conformational dynamics and stability. Additionally, the presence of functional groups such as the carboxylic acid enhances its solubility in polar solvents and may facilitate interactions in biological systems. Overall, this compound's intricate structure and functional characteristics make it of interest in fields such as medicinal chemistry and natural product synthesis.
Formula:C15H22O2
InChI:InChI=1S/C15H22O2/c1-9(13(16)17)5-4-6-14(2)10-7-11-12(8-10)15(11,14)3/h5,10-12H,4,6-8H2,1-3H3,(H,16,17)/b9-5+/t10?,11-,12+,14-,15-/m1/s1
InChI key:InChIKey=NZSCHTYUGUVLHG-LYMFXJNMSA-N
SMILES:C[C@]12[C@@]3([C@]1(CC([C@]2(CC/C=C(/C(O)=O)\C)C)C3)[H])[H]
Synonyms:- 2-Pentenoic acid, 5-[(1R,3R,6S)-2,3-dimethyltricyclo[2.2.1.02,6]hept-3-yl]-2-methyl-, (2E)-
- 2-Pentenoic acid, 5-(2,3-dimethyltricyclo[2.2.1.02,6]hept-3-yl)-2-methyl-, stereoisomer
- Tricyclo[2.2.1.02,6]heptane, 2-pentenoic acid deriv.
- (2E)-5-[(1R,3R,6S)-2,3-Dimethyltricyclo[2.2.1.02,6]hept-3-yl]-2-methyl-2-pentenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
a-Santal-10-en-12-oic acid
CAS:a-Santal-10-en-12-oic acid is a useful organic compound for research related to life sciences. The catalog number is T124279 and the CAS number is 74642-79-8.Formula:C15H22O2Color and Shape:SolidMolecular weight:234.339
