CAS 74644-88-5
:(3R,4R)-3,4-dihydroxy-L-proline
Description:
(3R,4R)-3,4-dihydroxy-L-proline is a naturally occurring amino acid derivative characterized by the presence of two hydroxyl (-OH) groups attached to the proline backbone. This compound is a stereoisomer of proline, specifically exhibiting the R configuration at both the 3 and 4 positions of the pyrrolidine ring. It is soluble in water due to its polar hydroxyl groups, which enhance its interaction with aqueous environments. The presence of these hydroxyl groups also contributes to its potential biological activity, as they can participate in hydrogen bonding and influence the compound's reactivity and interactions with other biomolecules. (3R,4R)-3,4-dihydroxy-L-proline is of interest in various fields, including biochemistry and pharmaceuticals, due to its role in protein structure and function, as well as its potential applications in drug design and development. Its CAS number, 74644-88-5, is a unique identifier that facilitates the search and reference of this specific compound in scientific literature and databases.
Formula:C5H9NO4
InChI:InChI=1/C5H9NO4/c7-2-1-6-3(4(2)8)5(9)10/h2-4,6-8H,1H2,(H,9,10)/t2-,3+,4+/m1/s1
Synonyms:- 2S,3R,4R-3,4-Dihydroxyproline
- L-Proline, 3,4-dihydroxy-, (3R,4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.