
CAS 74647-40-8
:Methyl 4-phenyl-2-pyrimidinecarboxylate
Description:
Methyl 4-phenyl-2-pyrimidinecarboxylate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the phenyl group enhances its aromatic characteristics and may influence its biological activity. Methyl 4-phenyl-2-pyrimidinecarboxylate is typically a white to off-white solid, and its melting point and boiling point can vary based on purity and environmental conditions. It is often used in synthetic organic chemistry as an intermediate in the production of pharmaceuticals and agrochemicals. The compound's properties, such as solubility, stability, and reactivity, make it a subject of interest in various chemical applications. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-16-12(15)11-13-8-7-10(14-11)9-5-3-2-4-6-9/h2-8H,1H3
InChI key:InChIKey=CUKXRIDBAMITNG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(C=CN1)C2=CC=CC=C2
Synonyms:- 2-Pyrimidinecarboxylic acid, 4-phenyl-, methyl ester
- Methyl 4-phenyl-2-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.