CAS 74649-88-0
:2-Decyl-1,4,7,10,13-pentaoxacyclopentadecane
Description:
2-Decyl-1,4,7,10,13-pentaoxacyclopentadecane, with CAS number 74649-88-0, is a synthetic compound characterized by its unique structure, which includes a long hydrophobic decyl chain and multiple ether linkages. This compound belongs to the class of polyether compounds, which are known for their flexibility and solubility in various solvents. The presence of five ether groups in its structure contributes to its potential as a surfactant or emulsifying agent, enhancing its ability to interact with both polar and non-polar substances. Additionally, the long alkyl chain imparts hydrophobic properties, making it useful in applications such as detergents, lubricants, or as a dispersant in formulations. Its molecular structure suggests that it may exhibit low toxicity and good biodegradability, aligning with the increasing demand for environmentally friendly chemical alternatives. Overall, 2-Decyl-1,4,7,10,13-pentaoxacyclopentadecane is a versatile compound with potential applications in various industrial and consumer products.
Formula:C20H40O5
InChI:InChI=1S/C20H40O5/c1-2-3-4-5-6-7-8-9-10-20-19-24-16-15-22-12-11-21-13-14-23-17-18-25-20/h20H,2-19H2,1H3
InChI key:InChIKey=OJJIHHOHJLKUBM-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)C1COCCOCCOCCOCCO1
Synonyms:- 2-Decyl-1,4,7,10,13-pentaoxacyclopentadecane
- 1,4,7,10,13-Pentaoxacyclopentadecane, 2-decyl-
- 2-Decyl-15-crown-5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
