CAS 74649-90-4
:2,2-Dimethyl-1,4,7,10,13-pentaoxacyclopentadecane
Description:
2,2-Dimethyl-1,4,7,10,13-pentaoxacyclopentadecane, with the CAS number 74649-90-4, is a cyclic ether compound characterized by its unique structure that includes five ether linkages within a 15-membered ring. This compound features two methyl groups attached to the second carbon, contributing to its overall stability and solubility properties. It is typically colorless and may exhibit a waxy texture. The presence of multiple ether groups imparts significant polarity, making it soluble in polar solvents while being less soluble in non-polar solvents. This compound is of interest in various applications, including as a potential ligand in coordination chemistry and in the development of polymeric materials due to its ability to form stable complexes. Its unique structure may also influence its reactivity, making it a subject of study in synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H24O5
InChI:InChI=1S/C12H24O5/c1-12(2)11-16-8-7-14-4-3-13-5-6-15-9-10-17-12/h3-11H2,1-2H3
InChI key:InChIKey=DFAFZVPNKONQTA-UHFFFAOYSA-N
SMILES:CC1(C)COCCOCCOCCOCCO1
Synonyms:- 2,2-Dimethyl-1,4,7,10,13-pentaoxacyclopentadecane
- 1,4,7,10,13-Pentaoxacyclopentadecane, 2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
