
CAS 74649-96-0
:2,2-Dimethyl-1,4,7,10-tetraoxacyclododecane
Description:
2,2-Dimethyl-1,4,7,10-tetraoxacyclododecane, commonly referred to as a cyclic ether, is a chemical compound characterized by its unique structure that includes four ether linkages within a twelve-membered ring. This compound features two methyl groups attached to the second carbon of the ring, contributing to its overall stability and solubility properties. It is typically a colorless liquid or solid at room temperature, depending on its specific formulation and purity. The presence of multiple ether groups imparts significant polarity, making it soluble in various organic solvents while exhibiting limited solubility in water. This compound is of interest in various fields, including materials science and organic synthesis, due to its potential applications as a ligand in coordination chemistry and as a building block in the synthesis of more complex molecules. Additionally, its structural characteristics may influence its reactivity and interaction with other chemical species, making it a subject of study in both academic and industrial research settings.
Formula:C10H20O4
InChI:InChI=1S/C10H20O4/c1-10(2)9-13-6-5-11-3-4-12-7-8-14-10/h3-9H2,1-2H3
InChI key:InChIKey=QKGREUBKUYOBTR-UHFFFAOYSA-N
SMILES:CC1(C)COCCOCCOCCO1
Synonyms:- 2,2-Dimethyl-1,4,7,10-tetraoxacyclododecane
- 1,4,7,10-Tetraoxacyclododecane, 2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
