CAS 7465-08-9

1-(2-aminophenyl)-3-(1-methylethyl)thiourea

Description:

1-(2-Aminophenyl)-3-(1-methylethyl)thiourea, with the CAS number 7465-08-9, is an organic compound characterized by the presence of a thiourea functional group. This compound features an aromatic amine (2-aminophenyl) and an isopropyl group (1-methylethyl) attached to the thiourea moiety. It typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the amino group contributes to its potential as a ligand in coordination chemistry, while the thiourea structure can exhibit biological activity, including antimicrobial and anticancer properties. The compound's reactivity is influenced by the thiourea's ability to form hydrogen bonds and coordinate with metal ions. Additionally, it may undergo various chemical transformations, such as oxidation or substitution reactions, depending on the reaction conditions. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₁₀H₁₅N₃S

InChI: InChI=1/C10H15N3S/c1-7(2)12-10(14)13-9-6-4-3-5-8(9)11/h3-7H,11H2,1-2H3,(H2,12,13,14)