CAS 7465-13-6

4-[2-(N-Acetylamino)ethyl]benzoic acid

Description:

4-[2-(N-Acetylamino)ethyl]benzoic acid, also known by its CAS number 7465-13-6, is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with an N-acetylaminoethyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both hydrophobic (the aromatic ring) and hydrophilic (the carboxylic acid and amide groups) functional groups. It exhibits properties typical of both carboxylic acids and amides, including the ability to form hydrogen bonds, which can influence its reactivity and interactions in biological systems. The compound may be utilized in various applications, including pharmaceuticals and biochemistry, due to its potential role as a building block in drug synthesis or as a biochemical probe. Its stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in practical applications.

Formula: C₁₁H₁₂NO₃

InChI: InChI=1/C11H13NO3/c1-8(13)12-7-6-9-2-4-10(5-3-9)11(14)15/h2-5H,6-7H2,1H3,(H,12,13)(H,14,15)/p-1

SMILES: CC(=NCCc1ccc(cc1)C(=O)O)[O-]

Synonyms:

• 4-[2-(Acetylamino)Ethyl]Benzoic Acid
• 4-[2-(Acetylamino)Ethyl]Benzoate

4-(2-Acetamidoethyl)benzoic acid

CAS: 7465-13-6

Versatile small molecule scaffold

Formula: C₁₁H₁₃NO₃

Purity: Min. 95%

Molecular weight: 207.23 g/mol

Ref: 3D-HAA46513