CAS 7465-63-6

2-(4-nitrophenyl)-4,5-dihydro-1,3-oxazole

Description:

2-(4-Nitrophenyl)-4,5-dihydro-1,3-oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a nitrophenyl group at the 2-position of the oxazole ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound typically exhibits a yellow to orange color due to the nitro group, which can also influence its electronic properties. It is generally soluble in organic solvents and may have limited solubility in water. The compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the nitro group can enhance its reactivity, making it a useful intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous. Overall, 2-(4-nitrophenyl)-4,5-dihydro-1,3-oxazole is a versatile compound with significant implications in chemical research and development.

Formula: C₉H₈N₂O₃

InChI: InChI=1/C9H8N2O3/c12-11(13)8-3-1-7(2-4-8)9-10-5-6-14-9/h1-4H,5-6H2

SMILES: c1cc(ccc1C1=NCCO1)N(=O)=O

Synonyms:

• Oxazole, 4,5-Dihydro-2-(4-Nitrophenyl)-