CAS 7465-87-4
:N-benzyl-4-methoxybenzamide
Description:
N-benzyl-4-methoxybenzamide, with the CAS number 7465-87-4, is an organic compound characterized by its amide functional group, which is formed by the reaction of a carboxylic acid and an amine. This compound features a benzyl group attached to the nitrogen atom of the amide, along with a methoxy group (-OCH3) on the para position of the aromatic ring. The presence of the methoxy group enhances the compound's lipophilicity and can influence its biological activity. N-benzyl-4-methoxybenzamide is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. Its structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the ability of amides to participate in hydrogen bonding and their role in influencing the pharmacokinetic properties of compounds. Additionally, the compound may exhibit various biological activities, making it of interest in medicinal chemistry research.
Formula:C15H15NO2
InChI:InChI=1/C15H15NO2/c1-18-14-9-7-13(8-10-14)15(17)16-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,16,17)
SMILES:COc1ccc(cc1)C(=O)NCc1ccccc1
Synonyms:- Benzamide, 4-methoxy-N-(phenylmethyl)-
- N-Benzyl-4-methoxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.