CAS 746595-89-1

(R)-3-Amino-4-(3-fluorophenyl)butyric acid

Description:

(R)-3-Amino-4-(3-fluorophenyl)butyric acid, with the CAS number 746595-89-1, is an amino acid derivative characterized by its chiral center, which contributes to its specific stereochemistry. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, allowing it to participate in various biochemical processes. The presence of a 3-fluorophenyl group enhances its potential for interactions in biological systems, possibly influencing its pharmacological properties. This compound is often studied for its role in neurotransmitter modulation and may have implications in the development of therapeutic agents. Its solubility and stability can vary depending on pH and temperature, which are important factors in its application in research and potential medicinal use. As a chiral molecule, it may exhibit different biological activities compared to its enantiomer, making stereochemistry a crucial aspect of its study. Overall, (R)-3-Amino-4-(3-fluorophenyl)butyric acid represents a significant compound in the field of medicinal chemistry and pharmacology.

Formula: C₁₀H₁₂FNO₂

InChI: InChI=1/C10H12FNO2/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1

SMILES: c1cc(cc(c1)F)C[C@H](CC(=O)O)N

Synonyms:

• (3R)-3-Amino-4-(3-fluorophenyl)butanoic acid
• benzenebutanoic acid, beta-amino-3-fluoro-, (betaR)-
• (R)-3-Amino-4-(3-Fluoro-Phenyl)-Butyric Acid