CAS 7466-32-2
:6-chloro-2-phenyl-1,3-benzothiazole
Description:
6-Chloro-2-phenyl-1,3-benzothiazole is an organic compound characterized by its benzothiazole core, which consists of a fused benzene and thiazole ring. The presence of a chlorine atom at the 6-position and a phenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is known for its potential applications in pharmaceuticals, agrochemicals, and as a fluorescent probe due to its ability to absorb and emit light. It may also possess biological activity, making it of interest in medicinal chemistry. The compound is generally stable under standard conditions but may undergo reactions typical of halogenated aromatic compounds, such as nucleophilic substitution or electrophilic aromatic substitution. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 6-chloro-2-phenyl-1,3-benzothiazole is a versatile compound with significant implications in various fields of research and industry.
Formula:C13H8ClNS
InChI:InChI=1/C13H8ClNS/c14-10-6-7-11-12(8-10)16-13(15-11)9-4-2-1-3-5-9/h1-8H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.