CAS 7466-38-8
:(E)-1-(4-ethoxyphenyl)-2-phenyldiazene
Description:
(E)-1-(4-ethoxyphenyl)-2-phenyldiazene, also known by its CAS number 7466-38-8, is an organic compound characterized by its azo functional group, which consists of a nitrogen-nitrogen double bond (N=N) linking two aromatic rings. This compound features an ethoxy group attached to one of the phenyl rings, enhancing its solubility in organic solvents. The (E) configuration indicates that the substituents on either side of the azo bond are on opposite sides, which can influence its reactivity and physical properties. Typically, azo compounds like this one exhibit vibrant colors and are often used as dyes or pigments in various applications. They can also participate in various chemical reactions, including azo coupling and reduction, making them valuable in synthetic organic chemistry. Additionally, the presence of the ethoxy group may impart specific electronic effects, affecting the compound's stability and reactivity. Overall, (E)-1-(4-ethoxyphenyl)-2-phenyldiazene is a notable example of azo compounds with potential applications in dye chemistry and materials science.
Formula:C14H14N2O
InChI:InChI=1/C14H14N2O/c1-2-17-14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11H,2H2,1H3/b16-15+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
