CAS 74661-16-8
:2-hydroxydodecanedioic acid
Description:
2-Hydroxydodecanedioic acid, with the CAS number 74661-16-8, is a dicarboxylic acid characterized by the presence of two carboxylic acid groups (-COOH) and a hydroxyl group (-OH) on a dodecane chain. This compound typically exhibits a white crystalline solid form at room temperature and is soluble in water due to its polar functional groups. The presence of the hydroxyl group contributes to its potential as a surfactant and its ability to form hydrogen bonds, enhancing its solubility in various solvents. 2-Hydroxydodecanedioic acid is often used in the synthesis of polyesters and polyamides, making it valuable in the production of biodegradable materials. Additionally, it may have applications in the cosmetic and pharmaceutical industries due to its potential as a skin-conditioning agent. Its chemical structure allows for various modifications, which can lead to derivatives with tailored properties for specific applications. Overall, this compound is notable for its multifunctionality and versatility in chemical synthesis and industrial applications.
Formula:C12H22O5
InChI:InChI=1/C12H22O5/c13-10(12(16)17)8-6-4-2-1-3-5-7-9-11(14)15/h10,13H,1-9H2,(H,14,15)(H,16,17)
SMILES:C(CCCCC(C(=O)O)O)CCCCC(=O)O
Synonyms:- Dodecanedioic Acid, 2-Hydroxy-
- 2-Hydroxydodecanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxydodecanedioic Acid
CAS:Controlled ProductFormula:C12H22O5Color and Shape:NeatMolecular weight:246.3
