CAS 746651-76-3: (2-bromophenyl)-(3-bromophenyl)methanone

Description:(2-bromophenyl)-(3-bromophenyl)methanone, with the CAS number 746651-76-3, is an organic compound characterized by the presence of two bromophenyl groups attached to a central carbonyl (ketone) functional group. This compound features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of bromine substituents on the phenyl rings enhances the compound's electrophilicity and can influence its reactivity in various chemical reactions, such as electrophilic aromatic substitution. The bromine atoms also contribute to the compound's physical properties, such as solubility and boiling point, which may differ from those of non-brominated analogs. Additionally, the compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to the unique electronic properties imparted by the bromine substituents. Overall, (2-bromophenyl)-(3-bromophenyl)methanone is a versatile compound with significant implications in chemical research and industry.

Formula:C₁₃H₈Br₂O

InChI:InChI=1/C13H8Br2O/c14-10-5-3-4-9(8-10)13(16)11-6-1-2-7-12(11)15/h1-8H

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2,3'-Dibromobenzophenone REF: 10-F201472CAS: 746651-76-3	97.0%	To inquire	Wed 14 May 25
	2,3'-Dibromobenzophenone REF: 3D-WEB65176CAS: 746651-76-3	Min. 95%	- - -	Discontinued product