CAS 746651-79-6
:ethyl 4-(3-bromobenzoyl)benzoate
Description:
Ethyl 4-(3-bromobenzoyl)benzoate is an organic compound characterized by its ester functional group, which is derived from the reaction of benzoic acid and ethanol. This compound features a bromobenzoyl group, indicating the presence of a bromine atom attached to a benzene ring, which can influence its reactivity and physical properties. The presence of the ethyl group contributes to its solubility in organic solvents. Ethyl 4-(3-bromobenzoyl)benzoate may exhibit moderate to high lipophilicity due to its aromatic structure, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions, and the bromine substituent can serve as a leaving group in nucleophilic substitution reactions. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be influenced by the specific arrangement of its atoms and the presence of functional groups. Overall, this compound is of interest in synthetic organic chemistry and material science.
Formula:C16H13BrO3
InChI:InChI=1/C16H13BrO3/c1-2-20-16(19)12-8-6-11(7-9-12)15(18)13-4-3-5-14(17)10-13/h3-10H,2H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.