CymitQuimica logo

CAS 746651-82-1

:

ethyl 2-(3-bromobenzoyl)benzoate

Description:
Ethyl 2-(3-bromobenzoyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a bromobenzoyl moiety, indicating the presence of a bromine atom attached to a benzene ring, which can influence its reactivity and physical properties. The presence of the ethyl group contributes to its solubility in organic solvents. Ethyl 2-(3-bromobenzoyl)benzoate may exhibit moderate to high lipophilicity due to its aromatic structure, making it potentially useful in various chemical applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions, and the bromine substituent can serve as a leaving group in nucleophilic substitution reactions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine atom and the overall steric environment of the molecule. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C16H13BrO3
InChI:InChI=1/C16H13BrO3/c1-2-20-16(19)14-9-4-3-8-13(14)15(18)11-6-5-7-12(17)10-11/h3-10H,2H2,1H3
SMILES:CCOC(=O)c1ccccc1C(=O)c1cccc(c1)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.