CAS 746651-87-6

(2-bromo-5-methoxy-phenyl)-(3-bromophenyl)methanone

Description:

(2-bromo-5-methoxy-phenyl)-(3-bromophenyl)methanone, with the CAS number 746651-87-6, is an organic compound characterized by its complex structure featuring a ketone functional group and multiple bromine and methoxy substituents on aromatic rings. This compound typically exhibits a high degree of lipophilicity due to the presence of bromine atoms, which can influence its reactivity and interaction with biological systems. The methoxy group contributes to its electron-donating properties, potentially affecting its chemical behavior and solubility in various solvents. As a brominated aromatic compound, it may also exhibit interesting photophysical properties, making it relevant in fields such as medicinal chemistry and materials science. Its synthesis and application could be of interest in the development of pharmaceuticals or agrochemicals, where halogenated compounds often play a crucial role in enhancing biological activity or stability. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds.

Formula: C₁₄H₁₀Br₂O₂

InChI: InChI=1/C14H10Br2O2/c1-18-11-5-6-13(16)12(8-11)14(17)9-3-2-4-10(15)7-9/h2-8H,1H3

SMILES: COc1ccc(c(c1)C(=O)c1cccc(c1)Br)Br