CAS 746651-88-7

Methanone, (2-bromo-5-methoxyphenyl)(4-fluorophenyl)-

Description:

Methanone, (2-bromo-5-methoxyphenyl)(4-fluorophenyl)-, also known by its CAS number 746651-88-7, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound includes a 2-bromo-5-methoxyphenyl moiety and a 4-fluorophenyl group, which contribute to its unique chemical properties. The presence of bromine and fluorine atoms introduces significant electronegativity, influencing the compound's reactivity and potential applications in medicinal chemistry. The methoxy group enhances solubility and can affect the compound's biological activity. Methanone derivatives are often studied for their potential in pharmaceuticals, particularly in the development of compounds with anti-cancer or anti-inflammatory properties. The compound's molecular interactions, stability, and reactivity can be further explored through various analytical techniques, including NMR spectroscopy and mass spectrometry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₀BrFO₂

InChI: InChI=1S/C14H10BrFO2/c1-18-11-6-7-13(15)12(8-11)14(17)9-2-4-10(16)5-3-9/h2-8H,1H3

InChI key: InChIKey=HVHCXFXBHLGHHQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC=C1Br)C2=CC=C(F)C=C2

Synonyms:

• 2-Bromo-4′-fluoro-5-methoxybenzophenone
• Methanone, (2-bromo-5-methoxyphenyl)(4-fluorophenyl)-
• (2-Bromo-5-methoxyphenyl)-(4-fluorophenyl)methanone