CAS 746651-89-8

(2-Bromo-5-methoxyphenyl)(4-chlorophenyl)methanone

Description:

(2-Bromo-5-methoxyphenyl)(4-chlorophenyl)methanone, with the CAS number 746651-89-8, is an organic compound characterized by its complex structure, which includes a methanone functional group attached to two aromatic rings. The presence of bromine and chlorine substituents on the phenyl rings contributes to its unique reactivity and potential applications in medicinal chemistry. The methoxy group enhances the compound's lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its synthesis typically involves electrophilic aromatic substitution reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity, particularly in terms of persistence and bioaccumulation. Overall, (2-Bromo-5-methoxyphenyl)(4-chlorophenyl)methanone represents a valuable structure in the field of organic chemistry and pharmaceutical research.

Formula: C₁₄H₁₀BrClO₂

InChI: InChI=1S/C14H10BrClO2/c1-18-11-6-7-13(15)12(8-11)14(17)9-2-4-10(16)5-3-9/h2-8H,1H3

InChI key: InChIKey=VDIKTPIPDWEQFN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC=C1Br)C2=CC=C(Cl)C=C2

Synonyms:

• (2-Bromo-5-methoxyphenyl)(4-chlorophenyl)methanone
• 2-Bromo-4′-chloro-5-methoxybenzophenone
• Methanone, (2-bromo-5-methoxyphenyl)(4-chlorophenyl)-